2,3,4,5-Tetrafluorbenzoylchloride

94695-48-4

2,3,4,5-Tetrafluorobenzoyl chloride is a fluorinated organic compound that falls under the category of benzoyl chlorides. It appears as a colorless liquid with a pungent odor and is primarily utilized as an intermediate in the synthesis of various pharmaceuticals and agrochemical compounds. Serving as an acylating agent, it can react with a wide range of nucleophiles, such as amines, alcohols, and thiols, to form amides, esters, or thioesters, respectively. Its unique fluorinated structure can impart desired characteristics to target molecules, such as enhanced lipophilicity or increased resistance to metabolic degradation. However, due to its high reactivity and potential health hazards, appropriate safety measures and handling procedures are essential when using this compound.

O=C(C1=CC(F)=C(C(F)=C1F)F)Cl

C7HClF4O

212.53

Ice Packs

-20°C