Pochonin D

544712-82-5

HSP, Interleukin, Virus Protease

Cytoskeletal Signaling, Metabolism, Immunology/Inflammation, Microbiology/Virology

Pochonin D is an inhibitor of heat shock protein 90 (Hsp90) with antiviral and anti-inflammatory properties. It disrupts Hsp90, affecting the stability, folding, and assembly of viral proteins, thereby diminishing viral replication. Additionally, Pochonin D reduces the infiltration of inflammatory cells and decreases the secretion of inflammatory cytokines such as TNF-α and IL-1β, alleviating inflammatory responses. This compound shows potential for research in human rhinovirus (HRV) infections and cancer.

ClC1=C2C(=C(O)C=C1O)C(=O)O[C@H](C)C/C=C/CC\C=C\C(=O)C2

C18H19ClO5

350.793

Ice Packs

-20°C